Index of /ROMs/SEGA/Sega Genesis/Best of Sega Genesis
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/binary.gif) | After Burner II (U) ..> | 2019-04-22 17:16 | 512K | |
| After Burner 32X (A)..> | 2019-04-22 17:16 | 2.0M | |
![[ ]](/icons/unknown.gif) | Alex Kidd in Shinobi..> | 2019-04-22 17:16 | 256K | |
| Alex Kidd in Shinobi..> | 2019-04-22 17:16 | 256K | |
| Aladdin (E) [!].bin | 2019-04-22 17:16 | 2.0M | |
| Alex Kidd in Shinobi..> | 2019-04-22 17:16 | 256K | |
| Alex Kidd in Shinobi..> | 2019-04-22 17:16 | 256K | |
| Alex Kidd in the Enc..> | 2019-04-22 17:16 | 256K | |
| Alex Kidd in the Enc..> | 2019-04-22 17:16 | 256K | |
| Alien 3 (JUE) [!] - ..> | 2019-04-22 17:16 | 512K | |
| Alien Storm (JUE) [!..> | 2019-04-22 17:16 | 512K | |
| Alien Soldier (U).bin | 2019-04-22 17:16 | 2.0M | |
| Aliens 3 (UE).bin | 2019-04-22 17:16 | 512K | |
| Altered Beast (JU) (..> | 2019-04-22 17:16 | 512K | |
| Alisia Dragoon (E) [..> | 2019-04-22 17:16 | 1.0M | |
| Atomic Runner (E) [!..> | 2019-04-22 17:16 | 1.0M | |
| barts_nightmare.bin | 2019-04-22 17:16 | 1.0M | |
| Battle Mania (U) [h1..> | 2019-04-22 17:16 | 512K | |
| bart_vs_mutants.bin | 2019-04-22 17:16 | 512K | |
| Battle Mania 2 jap.smd | 2019-04-22 17:16 | 1.0M | |
![[ ]](/icons/compressed.gif) | Battle Mania 2 Jap.zip | 2019-04-22 17:16 | 830K | |
| Battletoads and Doub..> | 2019-04-22 17:16 | 1.0M | |
| Blaster Master 2 (U)..> | 2019-04-22 17:16 | 1.0M | |
| Bonanza Brothers (JU..> | 2019-04-22 17:16 | 512K | |
| Beyond Oasis (4) [!]..> | 2019-04-22 17:16 | 3.0M | |
| Bonanza Brothers (JU..> | 2019-04-22 17:16 | 512K | |
| Burning Force (U) [!..> | 2019-04-22 17:16 | 512K | |
| Bubble and Squeek (U..> | 2019-04-22 17:16 | 512K | |
| Castlevania - Bloodl..> | 2019-04-22 17:16 | 1.0M | |
| Castlevania - The Ne..> | 2019-04-22 17:16 | 1.0M | |
| Chaos Engine, The (E..> | 2019-04-22 17:17 | 1.5M | |
| Chiki Chiki Boys (U)..> | 2019-04-22 17:17 | 1.0M | |
| Chuck Rock (U) [b1].bin | 2019-04-22 17:17 | 1.0M | |
| Chuck Rock 2 (U) [!]..> | 2019-04-22 17:17 | 1.0M | |
| Columns 3 - Revenge ..> | 2019-04-22 17:17 | 512K | |
| Clay Fighter (U) [!]..> | 2019-04-22 17:17 | 2.0M | |
| Comix Zone (1) [!].bin | 2019-04-22 17:17 | 2.0M | |
| Comix Zone (4) [!].bin | 2019-04-22 17:17 | 2.0M | |
| Crack Down (UE) [!].bin | 2019-04-22 17:17 | 512K | |
| Crue Ball (U) [!].bin | 2019-04-22 17:17 | 512K | |
| Contra - Hard Corps ..> | 2019-04-22 17:17 | 2.0M | |
| Dark Castle (UE) [!]..> | 2019-04-22 17:17 | 512K | |
| Decap Attack (UE) [!..> | 2019-04-22 17:17 | 512K | |
| Decap Attack (UJ).bin | 2019-04-22 17:17 | 512K | |
| Devil Crash MD (J) [..> | 2019-04-22 17:17 | 512K | |
| Disney Collection - ..> | 2019-04-22 17:17 | 1.0M | |
| Double Dragon (U) [!..> | 2019-04-22 17:17 | 512K | |
| Double Dragon 2 (J) ..> | 2019-04-22 17:17 | 512K | |
| Donald Duck in Maui ..> | 2019-04-22 17:17 | 3.0M | |
| Double Dragon 3 - Th..> | 2019-04-22 17:17 | 1.0M | |
| Dr. Robotnik's Mean ..> | 2019-04-22 17:17 | 1.0M | |
| Double Dragon V - Th..> | 2019-04-22 17:17 | 3.0M | |
| Dynamite Duke (JU) [..> | 2019-04-22 17:17 | 512K | |
| Dynamite Headdy (UE)..> | 2019-04-22 17:17 | 2.0M | |
| Earthworm Jim (E) [!..> | 2019-04-22 17:17 | 3.0M | |
| Earthworm Jim 2 (U).bin | 2019-04-22 17:17 | 3.0M | |
| ECCO (U) [!].bin | 2019-04-22 17:17 | 1.0M | |
| ECCO - The Tides of ..> | 2019-04-22 17:17 | 2.0M | |
| Ex-Mutants (U) [!].bin | 2019-04-22 17:17 | 1.0M | |
| Exodus (Unl) [c][!].bin | 2019-04-22 17:17 | 512K | |
| Fantastic Dizzy (UE)..> | 2019-04-22 17:17 | 512K | |
| ECCO Jr. (UJE) (Mar ..> | 2019-04-22 17:17 | 1.5M | |
| Fantasy Zone II - Th..> | 2019-04-22 17:17 | 257K | |
| Final Zone (JU) [!].bin | 2019-04-22 17:17 | 512K | |
| Fire Pro Wrestling G..> | 2019-04-22 17:17 | 512K | |
| Forgotten Worlds (JU..> | 2019-04-22 17:17 | 512K | |
| Flashback - The Ques..> | 2019-04-22 17:17 | 1.5M | |
| Frogger (UJ) [!].bin | 2019-04-22 17:17 | 384K | |
| Gaiares (JU) [!].bin | 2019-04-22 17:17 | 1.0M | |
| Galaxy Force II (JU)..> | 2019-04-22 17:17 | 1.0M | |
| Ghouls 'N Ghosts (JU..> | 2019-04-22 17:17 | 640K | |
| General Chaos (UEJ) ..> | 2019-04-22 17:17 | 1.0M | |
| Golden Axe (JU) (REV..> | 2019-04-22 17:17 | 512K | |
| Golden Axe II (JUE) ..> | 2019-04-22 17:17 | 512K | |
| Golden Axe III (J) [..> | 2019-04-22 17:17 | 1.0M | |
| Gunstar Heroes (E) [..> | 2019-04-22 17:17 | 1.0M | |
| Haunting, The (UEJ) ..> | 2019-04-22 17:17 | 2.0M | |
| Herzog Zwei (U) [!].bin | 2019-04-22 17:17 | 512K | |
| Jewel Master (U) [!]..> | 2019-04-22 17:17 | 512K | |
| Jelly Boy (JUE) [b1]..> | 2019-04-22 17:17 | 1.0M | |
| Journey From Darknes..> | 2019-04-22 17:17 | 1.0M | |
| Jungle Strike (UEJ) ..> | 2019-04-22 17:17 | 2.0M | |
| Jurassic Park - Ramp..> | 2019-04-22 17:17 | 2.0M | |
| Ka-Ge-Ki - Fists of ..> | 2019-04-22 17:17 | 1.0M | |
| Kid Chameleon (JUE) ..> | 2019-04-22 17:17 | 1.0M | |
| King of the Monsters..> | 2019-04-22 17:17 | 1.0M | |
| Klax (U) [!].bin | 2019-04-22 17:17 | 256K | |
| King of the Monsters..> | 2019-04-22 17:17 | 2.0M | |
| Knuckles Chaotix 32X..> | 2019-04-22 17:17 | 3.0M | |
| Lethal Enforcers (E)..> | 2019-04-22 17:17 | 2.0M | |
| Lethal Enforcers II ..> | 2019-04-22 17:17 | 2.0M | |
| Lightening Force (U)..> | 2019-04-22 17:17 | 1.0M | |
| M.U.S.H.A (U) [!].bin | 2019-04-22 17:17 | 512K | |
| Lion King, The (UEJ)..> | 2019-04-22 17:17 | 3.0M | |
| Magic Girl (Unl) [b1..> | 2019-04-22 17:17 | 512K | |
| Marble Madness (U) [..> | 2019-04-22 17:17 | 512K | |
| Mazin Saga (U) [!].bin | 2019-04-22 17:18 | 1.0M | |
| Maximum Carnage (UE)..> | 2019-04-22 17:18 | 2.0M | |
| McDonald's Treasure ..> | 2019-04-22 17:18 | 1.0M | |
| Mega Bomberman (UE).bin | 2019-04-22 17:18 | 1.0M | |
| Mega Turrican (E).bin | 2019-04-22 17:18 | 1.0M | |
| Mega Man - The Wily ..> | 2019-04-22 17:18 | 2.0M | |
| Michael Jackson's Mo..> | 2019-04-22 17:18 | 512K | |
| Mickey Mouse - Castl..> | 2019-04-22 17:18 | 512K | |
| Moonwalker (UE).bin | 2019-04-22 17:18 | 512K | |
| Mortal Combat 5 (Unl..> | 2019-04-22 17:18 | 2.0M | |
| Mortal Kombat (JUE) ..> | 2019-04-22 17:18 | 2.0M | |
| Mortal Kombat 3 (4) ..> | 2019-04-22 17:18 | 4.0M | |
| Mortal Kombat II (JU..> | 2019-04-22 17:18 | 3.0M | |
| Mystical Fighter (U)..> | 2019-04-22 17:18 | 512K | |
| New Zealand Story, T..> | 2019-04-22 17:18 | 512K | |
| Ninja Gaiden (JUE) [..> | 2019-04-22 17:18 | 256K | |
| Nobunaga's Ambition ..> | 2019-04-22 17:18 | 512K | |
| No Escape (U) [!].bin | 2019-04-22 17:18 | 2.0M | |
| OutRun (JU) [!].bin | 2019-04-22 17:18 | 1.0M | |
| OutRun 2019 (E) [!].bin | 2019-04-22 17:18 | 1.0M | |
| Pac-Attack (U) [!].bin | 2019-04-22 17:18 | 256K | |
| OutRunners (U) [!].bin | 2019-04-22 17:18 | 2.0M | |
| Pac-Mania (U) [!].bin | 2019-04-22 17:18 | 256K | |
| Pac-Man 2 - The New ..> | 2019-04-22 17:18 | 2.0M | |
| Panorama Cotton (J) ..> | 2019-04-22 17:18 | 2.5M | |
| Panorama Cotton (J) ..> | 2019-04-22 17:18 | 2.5M | |
| Pengo (F) [!].bin | 2019-04-22 17:18 | 1.0M | |
| Phelios (U) [b1].bin | 2019-04-22 17:18 | 512K | |
| Pitfall - The Mayan ..> | 2019-04-22 17:18 | 2.0M | |
| Predator 2 (JUE) [!]..> | 2019-04-22 17:18 | 1.0M | |
| Pitfall 32X (4) [!].bin | 2019-04-22 17:18 | 3.0M | |
| Psycho Pinball (JUE)..> | 2019-04-22 17:18 | 1.5M | |
| Primal Rage 32X (F) ..> | 2019-04-22 17:18 | 4.0M | |
| Rainbow Islands - Th..> | 2019-04-22 17:18 | 512K | |
| Quack Shot Starring ..> | 2019-04-22 17:18 | 1.3M | |
| Rastan Saga 2 (U) [!..> | 2019-04-22 17:18 | 512K | |
| Revenge of Shinobi, ..> | 2019-04-22 17:18 | 512K | |
| Rent A Hero (J) [!].bin | 2019-04-22 17:18 | 1.0M | |
| Road Rash (U) [b1].bin | 2019-04-22 17:18 | 512K | |
| Ristar (UE) [!].bin | 2019-04-22 17:18 | 2.0M | |
| Road Rash II (UEJ) [..> | 2019-04-22 17:18 | 1.0M | |
| Robocop 3 (UE) [!].bin | 2019-04-22 17:18 | 512K | |
| Road Rash 3 (UEJ) [!..> | 2019-04-22 17:18 | 2.0M | |
| Rocket Knight Advent..> | 2019-04-22 17:18 | 1.0M | |
| Robocop vs The Termi..> | 2019-04-22 17:18 | 2.0M | |
| Rockman Megaworld (J..> | 2019-04-22 17:18 | 2.0M | |
| Rockman X3 (Unl) [f1..> | 2019-04-22 17:18 | 2.0M | |
| Rolling Thunder 2 (E..> | 2019-04-22 17:18 | 1.0M | |
| Rolling Thunder 3 (U..> | 2019-04-22 17:18 | 2.0M | |
| Sega Arcade Classics..> | 2019-04-22 17:18 | 512K | |
| Shadow Dancer (JUE) ..> | 2019-04-22 17:18 | 512K | |
| Samurai Spirits (J) ..> | 2019-04-22 17:18 | 3.0M | |
| Shadow of the Beast ..> | 2019-04-22 17:18 | 1.0M | |
| Shadow of the Beast ..> | 2019-04-22 17:18 | 1.0M | |
| Shining Force (U) [!..> | 2019-04-22 17:18 | 1.5M | |
| Shining Force II (E)..> | 2019-04-22 17:18 | 2.0M | |
| Shining in the Darkn..> | 2019-04-22 17:19 | 1.0M | |
| Shining Force (U) [b..> | 2019-04-22 17:19 | 2.0M | |
| Shinobi 3 - Return o..> | 2019-04-22 17:19 | 1.0M | |
| Simpsons, The - Bart..> | 2019-04-22 17:19 | 512K | |
| Side Pocket (E).bin | 2019-04-22 17:19 | 1.0M | |
| Simpsons, The - Bart..> | 2019-04-22 17:19 | 1.0M | |
| Snake Rattle 'n' Rol..> | 2019-04-22 17:19 | 512K | |
| Snow Brothers (JUE) ..> | 2019-04-22 17:19 | 1.0M | |
| Sol-Deace (U) [!].bin | 2019-04-22 17:19 | 1.0M | |
| Soleil (E) (Eng).bin | 2019-04-22 17:19 | 2.0M | |
| Sonic 1 Gaslight.bin | 2019-04-22 17:19 | 514K | |
| Sonic 1 Spindash.bin | 2019-04-22 17:19 | 512K | |
| Sonic & Knuckles.bin | 2019-04-22 17:19 | 2.0M | |
| Sonic and Knuckles &..> | 2019-04-22 17:19 | 2.5M | |
| Sonic and Knuckles &..> | 2019-04-22 17:19 | 3.3M | |
| Sonic and Knuckles &..> | 2019-04-22 17:19 | 4.0M | |
| Sonic and Knuckles (..> | 2019-04-22 17:19 | 2.0M | |
| Sonic Compilation (A..> | 2019-04-22 17:19 | 3.0M | |
| Sonic Special Stages..> | 2019-04-22 17:19 | 2.5M | |
| Sonic the Hedgehog (..> | 2019-04-22 17:19 | 512K | |
| Sonic Spinball (E) [..> | 2019-04-22 17:19 | 1.0M | |
| Sonic the Hedgehog 2..> | 2019-04-22 17:19 | 1.0M | |
| Sorcerer's Kingdom (..> | 2019-04-22 17:19 | 1.0M | |
| Sonic the Hedgehog 3..> | 2019-04-22 17:19 | 2.0M | |
| Space Harrier 2 (JU)..> | 2019-04-22 17:19 | 512K | |
| Space Invaders 90 (J..> | 2019-04-22 17:19 | 256K | |
| Space Invaders 91 (U..> | 2019-04-22 17:19 | 256K | |
| Space Harrier 32X (J..> | 2019-04-22 17:19 | 2.0M | |
| Splatterhouse 2 (E) ..> | 2019-04-22 17:19 | 1.0M | |
| Splatterhouse 3 (J) ..> | 2019-04-22 17:19 | 2.0M | |
| Steel Empire, The (U..> | 2019-04-22 17:19 | 1.0M | |
| Star Wars Arcade 32X..> | 2019-04-22 17:19 | 2.5M | |
| Story of Thor, The -..> | 2019-04-22 17:19 | 3.0M | |
| Streets of Rage (JUE..> | 2019-04-22 17:19 | 512K | |
| Street Fighter 2 Spe..> | 2019-04-22 17:19 | 3.0M | |
| Streets of Rage 2 (U..> | 2019-04-22 17:19 | 2.0M | |
| Strider (UE) [!].bin | 2019-04-22 17:19 | 1.0M | |
| Streets of Rage 3 (E..> | 2019-04-22 17:19 | 3.0M | |
| Strider II (JUE) [R-..> | 2019-04-22 17:19 | 1.0M | |
| Sunset Riders (U) [!..> | 2019-04-22 17:19 | 512K | |
| Sub-Terrania (E) [!]..> | 2019-04-22 17:19 | 2.0M | |
| Super Bubble Bobble ..> | 2019-04-22 17:19 | 1.0M | |
| Super Fantasy Zone (..> | 2019-04-22 17:19 | 1.0M | |
| Super Donkey Kong 99..> | 2019-04-22 17:19 | 2.0M | |
| Super Shinobi II, Th..> | 2019-04-22 17:19 | 1.0M | |
| Super Mario World (U..> | 2019-04-22 17:19 | 2.0M | |
| Sword of Vermilion (..> | 2019-04-22 17:19 | 640K | |
| Tale Spin (U) [!].bin | 2019-04-22 17:19 | 512K | |
| Technocop (U) [!].bin | 2019-04-22 17:19 | 512K | |
| Teenage Mutant Hero ..> | 2019-04-22 17:19 | 1.0M | |
| Super Street Fighter..> | 2019-04-22 17:19 | 4.0M | |
| Teenage Mutant Ninja..> | 2019-04-22 17:19 | 1.0M | |
| Teenage Mutant Hero ..> | 2019-04-22 17:19 | 2.0M | |
| Teenage Mutant Ninja..> | 2019-04-22 17:20 | 1.0M | |
| Terminator 2 - Judge..> | 2019-04-22 17:20 | 1.0M | |
| Teenage Mutant Ninja..> | 2019-04-22 17:20 | 2.0M | |
| Terminator 2 - The A..> | 2019-04-22 17:20 | 1.0M | |
| Terminator, The (U).bin | 2019-04-22 17:20 | 1.0M | |
| Thunder Force II (U)..> | 2019-04-22 17:20 | 512K | |
| Thunder Force III (U..> | 2019-04-22 17:20 | 512K | |
| Todd's Adventures in..> | 2019-04-22 17:20 | 512K | |
| Trouble Shooter (U).bin | 2019-04-22 17:20 | 512K | |
| Thunder Force IV (U)..> | 2019-04-22 17:20 | 1.0M | |
| Truxton (JU) [!].bin | 2019-04-22 17:20 | 512K | |
| Turbo Outrun (JUE) [..> | 2019-04-22 17:20 | 512K | |
| Turrican (U) [b1].bin | 2019-04-22 17:20 | 512K | |
| Twinkle Tale (J).bin | 2019-04-22 17:20 | 1.0M | |
| Two Crude Dudes (T-1..> | 2019-04-22 17:20 | 1.0M | |
| Valis (U) [!].bin | 2019-04-22 17:20 | 1.0M | |
| Valis III (U) [!].bin | 2019-04-22 17:20 | 1.0M | |
| Vectorman (U).bin | 2019-04-22 17:20 | 2.0M | |
| Ultimate Mortal Komb..> | 2019-04-22 17:20 | 4.0M | |
| Vectorman 2 (U).bin | 2019-04-22 17:20 | 3.0M | |
| Virtua Fighter 2 (U)..> | 2019-04-22 17:20 | 4.0M | |
| Virtua Racing (U).bin | 2019-04-22 17:20 | 2.0M | |
| Virtua Fighter 32X (..> | 2019-04-22 17:20 | 4.0M | |
| Virtual Bart (JUE).bin | 2019-04-22 17:20 | 2.0M | |
| Wardner (U) [!].bin | 2019-04-22 17:20 | 512K | |
| Virtua Racing Deluxe..> | 2019-04-22 17:20 | 3.0M | |
| Wiz 'n' Liz (JUE) [!..> | 2019-04-22 17:20 | 1.0M | |
| Wonder Boy III - Mon..> | 2019-04-22 17:20 | 512K | |
| Weaponlord (4) [!].bin | 2019-04-22 17:20 | 3.0M | |
| Wonder Boy In Monste..> | 2019-04-22 17:20 | 768K | |
| Wonder Boy V - Monst..> | 2019-04-22 17:20 | 640K | |
| Zero Wing (U).bin | 2019-04-22 17:20 | 1.0M | |
| Zombies Ate My Neigh..> | 2019-04-22 17:20 | 1.0M | |
|
|---|