![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ain't Coming Home.wma | 2020-05-31 01:21 | 3.8M | |
| Champagne.wma | 2020-05-31 01:21 | 2.7M | |
| Chemical.wma | 2020-05-31 01:21 | 3.3M | |
| Crockett and Tubbs.wma | 2020-05-31 01:21 | 3.6M | |
| Department Store Gir..> | 2020-05-31 01:21 | 3.4M | |
| Little Bit More.wma | 2020-05-31 01:21 | 3.1M | |
| Nighttime Lover.wma | 2020-05-31 01:21 | 4.0M | |
| Non Stop.wma | 2020-05-31 01:21 | 3.8M | |
| Playboy Mansion.wma | 2020-05-31 01:28 | 3.2M | |
| Swing Swing.wma | 2020-05-31 01:28 | 3.6M | |
| Throw The Covers.wma | 2020-05-31 01:28 | 3.7M | |
| Word From The Bird.wma | 2020-05-31 01:28 | 2.2M | |